C17H23N3OS — CID 7288350
[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 7288350) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 7288350 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | C/C=C\Cn1c(C(=O)N2CCN(CC)CC2)cc2ccsc21 |
| InChI | InChI=1S/C17H23N3OS/c1-3-5-7-20-15(13-14-6-12-22-17(14)20)16(21)19-10-8-18(4-2)9-11-19/h3,5-6,12-13H,4,7-11H2,1-2H3/b5-3- |
| InChIKey | FFQDBKGTLVCXIO-HYXAFXHYSA-N |
| XLogP | 3.06 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|