C22H26N3OS+ — CID 7328397
(4-benzylpiperazin-4-ium-1-yl)-[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]methanone (PubChem CID 7328397) has the molecular formula C22H26N3OS+ and a molecular weight of 380.54 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 7328397 |
| Molecular Formula | C22H26N3OS+ |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]methanone |
| SMILES | C/C=C\Cn1c(C(=O)N2CC[NH+](Cc3ccccc3)CC2)cc2ccsc21 |
| InChI | InChI=1S/C22H25N3OS/c1-2-3-10-25-20(16-19-9-15-27-22(19)25)21(26)24-13-11-23(12-14-24)17-18-7-5-4-6-8-18/h2-9,15-16H,10-14,17H2,1H3/p+1/b3-2- |
| InChIKey | HXQXCNDGLJSKJC-IHWYPQMZSA-O |
| XLogP | 2.82 |
| TPSA | 29.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|