C14H18N5O+ — CID 4133383
(4-benzylpiperazin-4-ium-1-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 4133383) has the molecular formula C14H18N5O+ and a molecular weight of 272.33 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 4133383 |
| Molecular Formula | C14H18N5O+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H17N5O/c20-14(13-15-11-16-17-13)19-8-6-18(7-9-19)10-12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H,15,16,17)/p+1 |
| InChIKey | YPDUKPMDFAZLGT-UHFFFAOYSA-O |
| XLogP | -0.65 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |