C21H25N2OS+ — CID 2399633
(E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 2399633) has the molecular formula C21H25N2OS+ and a molecular weight of 353.51 g/mol. Its IUPAC name is (E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2399633 |
| Molecular Formula | C21H25N2OS+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(/C=C/C(=O)N2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N2OS/c1-25-20-10-7-18(8-11-20)9-12-21(24)23-15-13-22(14-16-23)17-19-5-3-2-4-6-19/h2-12H,13-17H2,1H3/p+1/b12-9+ |
| InChIKey | RYOWXBGIDPRJTM-FMIVXFBMSA-O |
| XLogP | 2.35 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|