C22H27N2O3+ — CID 9338805
(E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 9338805) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is (E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9338805 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (E)-1-(4-benzylpiperazin-4-ium-1-yl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CC[NH+](Cc3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C22H26N2O3/c1-26-20-10-6-9-19(22(20)27-2)11-12-21(25)24-15-13-23(14-16-24)17-18-7-4-3-5-8-18/h3-12H,13-17H2,1-2H3/p+1/b12-11+ |
| InChIKey | JOSUBFPWOOKLAI-VAWYXSNFSA-O |
| XLogP | 1.64 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|