C22H26ClN2O3+ — CID 8642956
(E)-1-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-3-(2,3-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8642956) has the molecular formula C22H26ClN2O3+ and a molecular weight of 401.91 g/mol. Its IUPAC name is (E)-1-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-3-(2,3-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-3-(2,3-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8642956 |
| Molecular Formula | C22H26ClN2O3+ |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (E)-1-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-3-(2,3-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CC[NH+](Cc3cccc(Cl)c3)CC2)c1OC |
| InChI | InChI=1S/C22H25ClN2O3/c1-27-20-8-4-6-18(22(20)28-2)9-10-21(26)25-13-11-24(12-14-25)16-17-5-3-7-19(23)15-17/h3-10,15H,11-14,16H2,1-2H3/p+1/b10-9+ |
| InChIKey | VHXFKYVGKJRITK-MDZDMXLPSA-O |
| XLogP | 2.30 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|