C23H29N2O2+ — CID 8641915
(E)-3-(2-ethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 8641915) has the molecular formula C23H29N2O2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is (E)-3-(2-ethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-ethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8641915 |
| Molecular Formula | C23H29N2O2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (E)-3-(2-ethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccccc1/C=C/C(=O)N1CC[NH+](Cc2ccccc2C)CC1 |
| InChI | InChI=1S/C23H28N2O2/c1-3-27-22-11-7-6-9-20(22)12-13-23(26)25-16-14-24(15-17-25)18-21-10-5-4-8-19(21)2/h4-13H,3,14-18H2,1-2H3/p+1/b13-12+ |
| InChIKey | QRLDTSRKRGKYJZ-OUKQBFOZSA-O |
| XLogP | 2.33 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|