C23H28ClN2O3+ — CID 8641621
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 8641621) has the molecular formula C23H28ClN2O3+ and a molecular weight of 415.94 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8641621 |
| Molecular Formula | C23H28ClN2O3+ |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CC[NH+](Cc3ccccc3C)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C23H27ClN2O3/c1-17-6-4-5-7-19(17)16-25-10-12-26(13-11-25)22(27)9-8-18-14-20(24)23(29-3)21(15-18)28-2/h4-9,14-15H,10-13,16H2,1-3H3/p+1/b9-8+ |
| InChIKey | AEGJRFLBAGUYNO-CMDGGOBGSA-O |
| XLogP | 2.61 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|