C24H29ClN2O3 — CID 34739056
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 34739056) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 34739056 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCCN(Cc3ccccc3C)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C24H29ClN2O3/c1-18-7-4-5-8-20(18)17-26-11-6-12-27(14-13-26)23(28)10-9-19-15-21(25)24(30-3)22(16-19)29-2/h4-5,7-10,15-16H,6,11-14,17H2,1-3H3/b10-9+ |
| InChIKey | RXUAWUSGUKHLEV-MDZDMXLPSA-N |
| XLogP | 4.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|