C25H33N2O6+ — CID 5124530
1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 5124530) has the molecular formula C25H33N2O6+ and a molecular weight of 457.55 g/mol. Its IUPAC name is 1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5124530 |
| Molecular Formula | C25H33N2O6+ |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)N2CC[NH+](CC(O)COc3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H32N2O6/c1-30-22-15-19(16-23(31-2)25(22)32-3)9-10-24(29)27-13-11-26(12-14-27)17-20(28)18-33-21-7-5-4-6-8-21/h4-10,15-16,20,28H,11-14,17-18H2,1-3H3/p+1 |
| InChIKey | NXUWVTHMTGCTBR-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|