C23H26ClN3O3 — CID 18528343
2-[(E)-3-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-oxoprop-1-enyl]benzonitrile chloride (PubChem CID 18528343) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-[(E)-3-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-oxoprop-1-enyl]benzonitrile chloride.
| Compound Name | 2-[(E)-3-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-oxoprop-1-enyl]benzonitrile chloride |
|---|---|
| PubChem CID | 18528343 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[(E)-3-[4-(2-hydroxy-3-phenoxypropyl)piperazin-4-ium-1-yl]-3-oxoprop-1-enyl]benzonitrile chloride |
| SMILES | N#Cc1ccccc1/C=C/C(=O)N1CC[NH+](CC(O)COc2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C23H25N3O3.ClH/c24-16-20-7-5-4-6-19(20)10-11-23(28)26-14-12-25(13-15-26)17-21(27)18-29-22-8-2-1-3-9-22;/h1-11,21,27H,12-15,17-18H2;1H/b11-10+; |
| InChIKey | BBJQVSDOLMATIK-ASTDGNLGSA-N |
| XLogP | -2.26 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|