C21H25N2O2S+ — CID 9077269
(E)-1-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-3-phenylsulfanylprop-2-en-1-one (PubChem CID 9077269) has the molecular formula C21H25N2O2S+ and a molecular weight of 369.51 g/mol. Its IUPAC name is (E)-1-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-3-phenylsulfanylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-3-phenylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 9077269 |
| Molecular Formula | C21H25N2O2S+ |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (E)-1-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-3-phenylsulfanylprop-2-en-1-one |
| SMILES | COc1ccc(C[NH+]2CCN(C(=O)/C=C/Sc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-25-19-9-7-18(8-10-19)17-22-12-14-23(15-13-22)21(24)11-16-26-20-5-3-2-4-6-20/h2-11,16H,12-15,17H2,1H3/p+1/b16-11+ |
| InChIKey | PUMUBGSXIPCNDJ-LFIBNONCSA-O |
| XLogP | 2.23 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|