C23H27N3O4S2 — CID 42797496
[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]methanone (PubChem CID 42797496) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]methanone.
| Compound Name | [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42797496 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]methanone |
| SMILES | C/C=C\Cn1c(C(=O)N2CCN(S(=O)(=O)c3ccc(OC)cc3)C(C)C2)cc2ccsc21 |
| InChI | InChI=1S/C23H27N3O4S2/c1-4-5-11-25-21(15-18-10-14-31-23(18)25)22(27)24-12-13-26(17(2)16-24)32(28,29)20-8-6-19(30-3)7-9-20/h4-10,14-15,17H,11-13,16H2,1-3H3/b5-4- |
| InChIKey | MOHQLZJSMCJFHY-PLNGDYQASA-N |
| XLogP | 3.82 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|