C25H26N3OS+ — CID 7437557
(4-benzylpiperazin-4-ium-1-yl)-(4-benzylthieno[3,2-b]pyrrol-5-yl)methanone (PubChem CID 7437557) has the molecular formula C25H26N3OS+ and a molecular weight of 416.57 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-(4-benzylthieno[3,2-b]pyrrol-5-yl)methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-(4-benzylthieno[3,2-b]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 7437557 |
| Molecular Formula | C25H26N3OS+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-(4-benzylthieno[3,2-b]pyrrol-5-yl)methanone |
| SMILES | O=C(c1cc2sccc2n1Cc1ccccc1)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3OS/c29-25(27-14-12-26(13-15-27)18-20-7-3-1-4-8-20)23-17-24-22(11-16-30-24)28(23)19-21-9-5-2-6-10-21/h1-11,16-17H,12-15,18-19H2/p+1 |
| InChIKey | ZARRXHHXXVKVQG-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 29.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |