C21H17Cl — CID 102471698
1-chloro-4-[(E,1R)-1,3-diphenylprop-2-enyl]benzene (PubChem CID 102471698) has the molecular formula C21H17Cl and a molecular weight of 304.82 g/mol. Its IUPAC name is 1-chloro-4-[(E,1R)-1,3-diphenylprop-2-enyl]benzene.
| Compound Name | 1-chloro-4-[(E,1R)-1,3-diphenylprop-2-enyl]benzene |
|---|---|
| PubChem CID | 102471698 |
| Molecular Formula | C21H17Cl |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-chloro-4-[(E,1R)-1,3-diphenylprop-2-enyl]benzene |
| SMILES | Clc1ccc([C@H](/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17Cl/c22-20-14-12-19(13-15-20)21(18-9-5-2-6-10-18)16-11-17-7-3-1-4-8-17/h1-16,21H/b16-11+/t21-/m1/s1 |
| InChIKey | YCDPQRKWQNSVGY-RBNQXFGJSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |