C17H16ClN — CID 11011042
(2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-amine (PubChem CID 11011042) has the molecular formula C17H16ClN and a molecular weight of 269.77 g/mol. Its IUPAC name is (2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 11011042 |
| Molecular Formula | C17H16ClN |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-amine |
| SMILES | NC(/C=C/C=C/c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN/c18-16-12-10-15(11-13-16)17(19)9-5-4-8-14-6-2-1-3-7-14/h1-13,17H,19H2/b8-4+,9-5+ |
| InChIKey | BZLSYJSLDHJHBD-KBXRYBNXSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|