C24H17ClO3 — CID 54714181
7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one (PubChem CID 54714181) has the molecular formula C24H17ClO3 and a molecular weight of 388.85 g/mol. Its IUPAC name is 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one.
| Compound Name | 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54714181 |
| Molecular Formula | C24H17ClO3 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2cc(Cl)ccc2c(O)c1C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17ClO3/c25-18-12-14-20-21(15-18)28-24(27)22(23(20)26)19(17-9-5-2-6-10-17)13-11-16-7-3-1-4-8-16/h1-15,19,26H/b13-11+ |
| InChIKey | OOQYFZIGEPHWAM-ACCUITESSA-N |
| XLogP | 6.00 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|