About 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one
7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one (PubChem CID 54714181) has the molecular formula C24H17ClO3
and a molecular weight of 388.85 g/mol. Its IUPAC name is 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one |
| PubChem CID | 54714181 |
| Molecular Formula | C24H17ClO3 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2cc(Cl)ccc2c(O)c1C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17ClO3/c25-18-12-14-20-21(15-18)28-24(27)22(23(20)26)19(17-9-5-2-6-10-17)13-11-16-7-3-1-4-8-16/h1-15,19,26H/b13-11+ |
| InChIKey | OOQYFZIGEPHWAM-ACCUITESSA-N |
| XLogP | 6.00 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one?
The IUPAC name of 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one (CID 54714181) is 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one.
What is the SMILES notation for 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one?
The canonical SMILES for 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one is O=c1oc2cc(Cl)ccc2c(O)c1C(/C=C/c1ccccc1)c1ccccc1.
What is the InChIKey of 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one?
The InChIKey is OOQYFZIGEPHWAM-ACCUITESSA-N. The full InChI is InChI=1S/C24H17ClO3/c25-18-12-14-20-21(15-18)28-24(27)22(23(20)26)19(17-9-5-2-6-10-17)13-11-16-7-3-1-4-8-16/h1-15,19,26H/b13-11+.
What are the key properties of 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one?
7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one has a molecular weight of 388.85 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-[(E)-1,3-diphenylprop-2-enyl]-4-hydroxychromen-2-one is sourced from PubChem (CID 54714181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).