C12H15Cl — CID 138964218
1-chloro-4-[(E,3S)-3-methylpent-1-enyl]benzene (PubChem CID 138964218) has the molecular formula C12H15Cl and a molecular weight of 194.71 g/mol. Its IUPAC name is 1-chloro-4-[(E,3S)-3-methylpent-1-enyl]benzene.
| Compound Name | 1-chloro-4-[(E,3S)-3-methylpent-1-enyl]benzene |
|---|---|
| PubChem CID | 138964218 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-chloro-4-[(E,3S)-3-methylpent-1-enyl]benzene |
| SMILES | CC[C@H](C)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15Cl/c1-3-10(2)4-5-11-6-8-12(13)9-7-11/h4-10H,3H2,1-2H3/b5-4+/t10-/m0/s1 |
| InChIKey | FWVQXGXTHVTYCJ-YEZKRMTDSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |