C13H19Cl2N — CID 70285128
(E,3S)-1-(4-chlorophenyl)-5-methylhex-1-en-3-amine;hydrochloride (PubChem CID 70285128) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is (E,3S)-1-(4-chlorophenyl)-5-methylhex-1-en-3-amine;hydrochloride.
| Compound Name | (E,3S)-1-(4-chlorophenyl)-5-methylhex-1-en-3-amine;hydrochloride |
|---|---|
| PubChem CID | 70285128 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (E,3S)-1-(4-chlorophenyl)-5-methylhex-1-en-3-amine;hydrochloride |
| SMILES | CC(C)C[C@H](N)/C=C/c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C13H18ClN.ClH/c1-10(2)9-13(15)8-5-11-3-6-12(14)7-4-11;/h3-8,10,13H,9,15H2,1-2H3;1H/b8-5+;/t13-;/m1./s1 |
| InChIKey | UHLXJEHWOWLQPD-WYFFVQCESA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |