C23H22ClNO4S — CID 67117598
3-[[(4-chlorophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]methyl]benzoic acid (PubChem CID 67117598) has the molecular formula C23H22ClNO4S and a molecular weight of 443.95 g/mol. Its IUPAC name is 3-[[(4-chlorophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[(4-chlorophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 67117598 |
| Molecular Formula | C23H22ClNO4S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-[[(4-chlorophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]methyl]benzoic acid |
| SMILES | CC[C@@H](c1ccccc1)N(Cc1cccc(C(=O)O)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClNO4S/c1-2-22(18-8-4-3-5-9-18)25(16-17-7-6-10-19(15-17)23(26)27)30(28,29)21-13-11-20(24)12-14-21/h3-15,22H,2,16H2,1H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | SNQMDMRNVJLRNV-QFIPXVFZSA-N |
| XLogP | 5.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |