C22H20ClN3O2S — CID 66978799
4-chloro-N-[(5-cyano-2-pyridinyl)methyl]-N-[(1S)-1-phenylpropyl]benzenesulfonamide (PubChem CID 66978799) has the molecular formula C22H20ClN3O2S and a molecular weight of 425.94 g/mol. Its IUPAC name is 4-chloro-N-[(5-cyano-2-pyridinyl)methyl]-N-[(1S)-1-phenylpropyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(5-cyano-2-pyridinyl)methyl]-N-[(1S)-1-phenylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66978799 |
| Molecular Formula | C22H20ClN3O2S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-chloro-N-[(5-cyano-2-pyridinyl)methyl]-N-[(1S)-1-phenylpropyl]benzenesulfonamide |
| SMILES | CC[C@@H](c1ccccc1)N(Cc1ccc(C#N)cn1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3O2S/c1-2-22(18-6-4-3-5-7-18)26(16-20-11-8-17(14-24)15-25-20)29(27,28)21-12-9-19(23)10-13-21/h3-13,15,22H,2,16H2,1H3/t22-/m0/s1 |
| InChIKey | KZIDYJGPSGFSGL-QFIPXVFZSA-N |
| XLogP | 4.95 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |