C24H18ClN3O2S — CID 58129078
4-chloro-N-[(4-cyanophenyl)methyl]-N-(isoquinolin-3-ylmethyl)benzenesulfonamide (PubChem CID 58129078) has the molecular formula C24H18ClN3O2S and a molecular weight of 447.95 g/mol. Its IUPAC name is 4-chloro-N-[(4-cyanophenyl)methyl]-N-(isoquinolin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4-cyanophenyl)methyl]-N-(isoquinolin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58129078 |
| Molecular Formula | C24H18ClN3O2S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-chloro-N-[(4-cyanophenyl)methyl]-N-(isoquinolin-3-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(CN(Cc2cc3ccccc3cn2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H18ClN3O2S/c25-22-9-11-24(12-10-22)31(29,30)28(16-19-7-5-18(14-26)6-8-19)17-23-13-20-3-1-2-4-21(20)15-27-23/h1-13,15H,16-17H2 |
| InChIKey | GAOXMEYJZZHOLX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |