C22H19ClF2N2O4S — CID 21075497
2-[(4-chlorophenyl)sulfonyl-[[3-(difluoromethoxy)phenyl]methyl]amino]-2-phenylacetamide (PubChem CID 21075497) has the molecular formula C22H19ClF2N2O4S and a molecular weight of 480.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[[3-(difluoromethoxy)phenyl]methyl]amino]-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[[3-(difluoromethoxy)phenyl]methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 21075497 |
| Molecular Formula | C22H19ClF2N2O4S |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[[3-(difluoromethoxy)phenyl]methyl]amino]-2-phenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)N(Cc1cccc(OC(F)F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClF2N2O4S/c23-17-9-11-19(12-10-17)32(29,30)27(20(21(26)28)16-6-2-1-3-7-16)14-15-5-4-8-18(13-15)31-22(24)25/h1-13,20,22H,14H2,(H2,26,28) |
| InChIKey | OINIEXAPVGKRBJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |