C27H22ClFN2O4S — CID 21075488
2-[(4-chlorophenyl)sulfonyl-[[3-(2-fluorophenoxy)phenyl]methyl]amino]-2-phenylacetamide (PubChem CID 21075488) has the molecular formula C27H22ClFN2O4S and a molecular weight of 525.00 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[[3-(2-fluorophenoxy)phenyl]methyl]amino]-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[[3-(2-fluorophenoxy)phenyl]methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 21075488 |
| Molecular Formula | C27H22ClFN2O4S |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[[3-(2-fluorophenoxy)phenyl]methyl]amino]-2-phenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)N(Cc1cccc(Oc2ccccc2F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClFN2O4S/c28-21-13-15-23(16-14-21)36(33,34)31(26(27(30)32)20-8-2-1-3-9-20)18-19-7-6-10-22(17-19)35-25-12-5-4-11-24(25)29/h1-17,26H,18H2,(H2,30,32) |
| InChIKey | NGIOBGJMJBZCPW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |