C23H19ClN4O3S2 — CID 21075505
2-[(4-chlorophenyl)sulfonyl-[[4-(thiadiazol-4-yl)phenyl]methyl]amino]-2-phenylacetamide (PubChem CID 21075505) has the molecular formula C23H19ClN4O3S2 and a molecular weight of 499.02 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[[4-(thiadiazol-4-yl)phenyl]methyl]amino]-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[[4-(thiadiazol-4-yl)phenyl]methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 21075505 |
| Molecular Formula | C23H19ClN4O3S2 |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[[4-(thiadiazol-4-yl)phenyl]methyl]amino]-2-phenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)N(Cc1ccc(-c2csnn2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClN4O3S2/c24-19-10-12-20(13-11-19)33(30,31)28(22(23(25)29)18-4-2-1-3-5-18)14-16-6-8-17(9-7-16)21-15-32-27-26-21/h1-13,15,22H,14H2,(H2,25,29) |
| InChIKey | FPUDDPVIWMLDLY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |