C28H41N3O4 — CID 42696660
ethyl 4-[[5-(diethylamino)pentan-2-yl-[(4-ethoxyphenyl)methyl]carbamoyl]amino]benzoate (PubChem CID 42696660) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is ethyl 4-[[5-(diethylamino)pentan-2-yl-[(4-ethoxyphenyl)methyl]carbamoyl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(diethylamino)pentan-2-yl-[(4-ethoxyphenyl)methyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 42696660 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | ethyl 4-[[5-(diethylamino)pentan-2-yl-[(4-ethoxyphenyl)methyl]carbamoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N(Cc2ccc(OCC)cc2)C(C)CCCN(CC)CC)cc1 |
| InChI | InChI=1S/C28H41N3O4/c1-6-30(7-2)20-10-11-22(5)31(21-23-12-18-26(19-13-23)34-8-3)28(33)29-25-16-14-24(15-17-25)27(32)35-9-4/h12-19,22H,6-11,20-21H2,1-5H3,(H,29,33) |
| InChIKey | ZCJDTLSSILVXLP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |