C29H38N2O2 — CID 3573105
N-[5-(diethylamino)pentan-2-yl]-N-[(4-ethoxyphenyl)methyl]naphthalene-2-carboxamide (PubChem CID 3573105) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-N-[(4-ethoxyphenyl)methyl]naphthalene-2-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-N-[(4-ethoxyphenyl)methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3573105 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-N-[(4-ethoxyphenyl)methyl]naphthalene-2-carboxamide |
| SMILES | CCOc1ccc(CN(C(=O)c2ccc3ccccc3c2)C(C)CCCN(CC)CC)cc1 |
| InChI | InChI=1S/C29H38N2O2/c1-5-30(6-2)20-10-11-23(4)31(22-24-14-18-28(19-15-24)33-7-3)29(32)27-17-16-25-12-8-9-13-26(25)21-27/h8-9,12-19,21,23H,5-7,10-11,20,22H2,1-4H3 |
| InChIKey | WZJVRXGAQIPMSA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |