C28H36N2O2S — CID 42700694
N-[5-(diethylamino)pentan-2-yl]-N-[(4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide (PubChem CID 42700694) has the molecular formula C28H36N2O2S and a molecular weight of 464.68 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-N-[(4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-N-[(4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42700694 |
| Molecular Formula | C28H36N2O2S |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-N-[(4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)CCCC(C)N(Cc1ccc(OCc2ccccc2)cc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C28H36N2O2S/c1-4-29(5-2)19-9-11-23(3)30(28(31)27-14-10-20-33-27)21-24-15-17-26(18-16-24)32-22-25-12-7-6-8-13-25/h6-8,10,12-18,20,23H,4-5,9,11,19,21-22H2,1-3H3 |
| InChIKey | WKSYUTFBAYVSHR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |