C31H41N3O3 — CID 42700707
1-[5-(diethylamino)pentan-2-yl]-3-(2-methoxyphenyl)-1-[(4-phenylmethoxyphenyl)methyl]urea (PubChem CID 42700707) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-(2-methoxyphenyl)-1-[(4-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-(2-methoxyphenyl)-1-[(4-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42700707 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-(2-methoxyphenyl)-1-[(4-phenylmethoxyphenyl)methyl]urea |
| SMILES | CCN(CC)CCCC(C)N(Cc1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C31H41N3O3/c1-5-33(6-2)22-12-13-25(3)34(31(35)32-29-16-10-11-17-30(29)36-4)23-26-18-20-28(21-19-26)37-24-27-14-8-7-9-15-27/h7-11,14-21,25H,5-6,12-13,22-24H2,1-4H3,(H,32,35) |
| InChIKey | AUALINVAIRHGNR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |