C23H24N2O3 — CID 7830477
(2R)-N-(2-methoxyphenyl)-2-(4-phenylmethoxyanilino)propanamide (PubChem CID 7830477) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2R)-N-(2-methoxyphenyl)-2-(4-phenylmethoxyanilino)propanamide.
| Compound Name | (2R)-N-(2-methoxyphenyl)-2-(4-phenylmethoxyanilino)propanamide |
|---|---|
| PubChem CID | 7830477 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2R)-N-(2-methoxyphenyl)-2-(4-phenylmethoxyanilino)propanamide |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-17(23(26)25-21-10-6-7-11-22(21)27-2)24-19-12-14-20(15-13-19)28-16-18-8-4-3-5-9-18/h3-15,17,24H,16H2,1-2H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | FJHBZHZZDPOHKQ-QGZVFWFLSA-N |
| XLogP | 4.71 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|