C29H32N2O5S — CID 92695591
(2S)-2-[(4-ethoxycarbonylphenyl)methyl-[(4-phenoxyphenyl)carbamothioyl]amino]-4-methylpentanoic acid (PubChem CID 92695591) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is (2S)-2-[(4-ethoxycarbonylphenyl)methyl-[(4-phenoxyphenyl)carbamothioyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(4-ethoxycarbonylphenyl)methyl-[(4-phenoxyphenyl)carbamothioyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 92695591 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (2S)-2-[(4-ethoxycarbonylphenyl)methyl-[(4-phenoxyphenyl)carbamothioyl]amino]-4-methylpentanoic acid |
| SMILES | CCOC(=O)c1ccc(CN(C(=S)Nc2ccc(Oc3ccccc3)cc2)[C@@H](CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C29H32N2O5S/c1-4-35-28(34)22-12-10-21(11-13-22)19-31(26(27(32)33)18-20(2)3)29(37)30-23-14-16-25(17-15-23)36-24-8-6-5-7-9-24/h5-17,20,26H,4,18-19H2,1-3H3,(H,30,37)(H,32,33)/t26-/m0/s1 |
| InChIKey | UMSUWOJJUDCBPS-SANMLTNESA-N |
| XLogP | 6.35 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|