C24H28ClN2O4S- — CID 4547799
2-[(3-chloro-4-methylphenyl)carbamothioyl-[(4-ethoxycarbonylphenyl)methyl]amino]-4-methylpentanoate (PubChem CID 4547799) has the molecular formula C24H28ClN2O4S- and a molecular weight of 476.02 g/mol. Its IUPAC name is 2-[(3-chloro-4-methylphenyl)carbamothioyl-[(4-ethoxycarbonylphenyl)methyl]amino]-4-methylpentanoate.
| Compound Name | 2-[(3-chloro-4-methylphenyl)carbamothioyl-[(4-ethoxycarbonylphenyl)methyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 4547799 |
| Molecular Formula | C24H28ClN2O4S- |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[(3-chloro-4-methylphenyl)carbamothioyl-[(4-ethoxycarbonylphenyl)methyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)c1ccc(CN(C(=S)Nc2ccc(C)c(Cl)c2)C(CC(C)C)C(=O)[O-])cc1 |
| InChI | InChI=1S/C24H29ClN2O4S/c1-5-31-23(30)18-9-7-17(8-10-18)14-27(21(22(28)29)12-15(2)3)24(32)26-19-11-6-16(4)20(25)13-19/h6-11,13,15,21H,5,12,14H2,1-4H3,(H,26,32)(H,28,29)/p-1 |
| InChIKey | ZLVKXQYNHZDUQW-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|