C19H19F3N2O2S — CID 24501883
ethyl 4-[[benzyl(2,2,2-trifluoroethyl)carbamothioyl]amino]benzoate (PubChem CID 24501883) has the molecular formula C19H19F3N2O2S and a molecular weight of 396.43 g/mol. Its IUPAC name is ethyl 4-[[benzyl(2,2,2-trifluoroethyl)carbamothioyl]amino]benzoate.
| Compound Name | ethyl 4-[[benzyl(2,2,2-trifluoroethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 24501883 |
| Molecular Formula | C19H19F3N2O2S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | ethyl 4-[[benzyl(2,2,2-trifluoroethyl)carbamothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N(Cc2ccccc2)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O2S/c1-2-26-17(25)15-8-10-16(11-9-15)23-18(27)24(13-19(20,21)22)12-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,23,27) |
| InChIKey | QLNSJZYUZJOGIJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|