C25H35N3O — CID 42702545
3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 42702545) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 42702545 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | CC(C)(C)c1ccc(CN(CCN2CCCC2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H35N3O/c1-25(2,3)23-13-11-22(12-14-23)20-28(18-17-27-15-7-8-16-27)24(29)26-19-21-9-5-4-6-10-21/h4-6,9-14H,7-8,15-20H2,1-3H3,(H,26,29) |
| InChIKey | VXYGJOSESDBQFC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |