C26H36N2O — CID 42697562
N-[(4-tert-butylphenyl)methyl]-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 42697562) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 42697562 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | CC(C)(C)c1ccc(CN(CCN2CCCCC2)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H36N2O/c1-26(2,3)24-14-12-23(13-15-24)21-28(19-18-27-16-8-5-9-17-27)25(29)20-22-10-6-4-7-11-22/h4,6-7,10-15H,5,8-9,16-21H2,1-3H3 |
| InChIKey | MOWMYZCAPWZILE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |