C29H42N2O3 — CID 42701112
2-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(4-phenylmethoxyphenyl)methyl]hexanamide (PubChem CID 42701112) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 2-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(4-phenylmethoxyphenyl)methyl]hexanamide.
| Compound Name | 2-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(4-phenylmethoxyphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 42701112 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | 2-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(4-phenylmethoxyphenyl)methyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCCN1CCOCC1)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H42N2O3/c1-3-5-12-27(4-2)29(32)31(18-9-17-30-19-21-33-22-20-30)23-25-13-15-28(16-14-25)34-24-26-10-7-6-8-11-26/h6-8,10-11,13-16,27H,3-5,9,12,17-24H2,1-2H3 |
| InChIKey | UNHQTBQTOSFUCP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |