C24H23N3O2 — CID 138903568
N-benzyl-2-(1H-indol-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine (PubChem CID 138903568) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-benzyl-2-(1H-indol-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine.
| Compound Name | N-benzyl-2-(1H-indol-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 138903568 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-benzyl-2-(1H-indol-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine |
| SMILES | O=[N+]([O-])c1ccc(CN(CCc2c[nH]c3ccccc23)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O2/c28-27(29)22-12-10-20(11-13-22)18-26(17-19-6-2-1-3-7-19)15-14-21-16-25-24-9-5-4-8-23(21)24/h1-13,16,25H,14-15,17-18H2 |
| InChIKey | VKYPQIUXXFFWDJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|