C11H18N4O2 — CID 14697636
N'-(2-aminoethyl)-N'-[(4-nitrophenyl)methyl]ethane-1,2-diamine (PubChem CID 14697636) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-[(4-nitrophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-[(4-nitrophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 14697636 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N'-(2-aminoethyl)-N'-[(4-nitrophenyl)methyl]ethane-1,2-diamine |
| SMILES | NCCN(CCN)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H18N4O2/c12-5-7-14(8-6-13)9-10-1-3-11(4-2-10)15(16)17/h1-4H,5-9,12-13H2 |
| InChIKey | NAFVQANZPHTQQI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|