C26H21N7O2 — CID 146310760
N,N-dibenzyl-4-nitro-6-[2-(2H-tetrazol-5-yl)phenyl]pyridin-2-amine (PubChem CID 146310760) has the molecular formula C26H21N7O2 and a molecular weight of 463.50 g/mol. Its IUPAC name is N,N-dibenzyl-4-nitro-6-[2-(2H-tetrazol-5-yl)phenyl]pyridin-2-amine.
| Compound Name | N,N-dibenzyl-4-nitro-6-[2-(2H-tetrazol-5-yl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 146310760 |
| Molecular Formula | C26H21N7O2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N,N-dibenzyl-4-nitro-6-[2-(2H-tetrazol-5-yl)phenyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2-c2nn[nH]n2)nc(N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C26H21N7O2/c34-33(35)21-15-24(22-13-7-8-14-23(22)26-28-30-31-29-26)27-25(16-21)32(17-19-9-3-1-4-10-19)18-20-11-5-2-6-12-20/h1-16H,17-18H2,(H,28,29,30,31) |
| InChIKey | UEJHSWIVUSRYNG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|