C20H24N4O5 — CID 59827347
N-[[4-(diethoxymethyl)phenyl]methyl]-N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 59827347) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[[4-(diethoxymethyl)phenyl]methyl]-N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[[4-(diethoxymethyl)phenyl]methyl]-N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 59827347 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[[4-(diethoxymethyl)phenyl]methyl]-N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCOC(OCC)c1ccc(CN(CC)c2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-4-23(16-11-12-17(24(25)26)19-18(16)21-29-22-19)13-14-7-9-15(10-8-14)20(27-5-2)28-6-3/h7-12,20H,4-6,13H2,1-3H3 |
| InChIKey | LPPDEQALHQVAAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|