C13H11Cl2N7O4 — CID 3343197
2-[[7-[(4,6-dichloropyrimidin-5-yl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol (PubChem CID 3343197) has the molecular formula C13H11Cl2N7O4 and a molecular weight of 400.18 g/mol. Its IUPAC name is 2-[[7-[(4,6-dichloropyrimidin-5-yl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol.
| Compound Name | 2-[[7-[(4,6-dichloropyrimidin-5-yl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 3343197 |
| Molecular Formula | C13H11Cl2N7O4 |
| Molecular Weight | 400.18 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[[7-[(4,6-dichloropyrimidin-5-yl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
| SMILES | CN(CCO)c1cc(Nc2c(Cl)ncnc2Cl)c2nonc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11Cl2N7O4/c1-21(2-3-23)7-4-6(18-10-12(14)16-5-17-13(10)15)8-9(20-26-19-8)11(7)22(24)25/h4-5,18,23H,2-3H2,1H3 |
| InChIKey | PYFBCFJZTSLMCZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|