C14H19N5O6S — CID 3783466
2-[[7-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol (PubChem CID 3783466) has the molecular formula C14H19N5O6S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[[7-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol.
| Compound Name | 2-[[7-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 3783466 |
| Molecular Formula | C14H19N5O6S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[[7-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
| SMILES | CN(CCO)c1cc(N(C)C2CCS(=O)(=O)C2)c2nonc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O6S/c1-17(4-5-20)11-7-10(18(2)9-3-6-26(23,24)8-9)12-13(16-25-15-12)14(11)19(21)22/h7,9,20H,3-6,8H2,1-2H3 |
| InChIKey | VVTIPKCISVODNI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|