C11H16N2O5S2 — CID 103941559
(1R)-1-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitrothiophen-2-yl]ethanol (PubChem CID 103941559) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (1R)-1-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1R)-1-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103941559 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (1R)-1-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-4-nitrothiophen-2-yl]ethanol |
| SMILES | C[C@@H](O)c1cc([N+](=O)[O-])c(N(C)C2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-7(14)10-5-9(13(15)16)11(19-10)12(2)8-3-4-20(17,18)6-8/h5,7-8,14H,3-4,6H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | OSDRVAMCMLVACA-GVHYBUMESA-N |
| XLogP | 1.33 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|