C15H22N2O3S — CID 103941930
(1R)-1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanol (PubChem CID 103941930) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (1R)-1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1R)-1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103941930 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (1R)-1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanol |
| SMILES | C[C@@H](O)c1cc([N+](=O)[O-])c(N(C)CC2CC3CCC2C3)s1 |
| InChI | InChI=1S/C15H22N2O3S/c1-9(18)14-7-13(17(19)20)15(21-14)16(2)8-12-6-10-3-4-11(12)5-10/h7,9-12,18H,3-6,8H2,1-2H3/t9-,10?,11?,12?/m1/s1 |
| InChIKey | YTIOHNDPPVFDOG-QBWABLMJSA-N |
| XLogP | 3.58 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|