C15H20N2O3S — CID 115964157
1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanone (PubChem CID 115964157) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanone.
| Compound Name | 1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 115964157 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-[5-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-4-nitrothiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(N(C)CC2CC3CCC2C3)s1 |
| InChI | InChI=1S/C15H20N2O3S/c1-9(18)14-7-13(17(19)20)15(21-14)16(2)8-12-6-10-3-4-11(12)5-10/h7,10-12H,3-6,8H2,1-2H3 |
| InChIKey | DTSALFAVAARBNZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|