C12H7ClIN4O3P — CID 144870021
N-(5-chloro-4-iodo-2-phosphanylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 144870021) has the molecular formula C12H7ClIN4O3P and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(5-chloro-4-iodo-2-phosphanylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | N-(5-chloro-4-iodo-2-phosphanylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 144870021 |
| Molecular Formula | C12H7ClIN4O3P |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 447.90 |
| IUPAC Name | N-(5-chloro-4-iodo-2-phosphanylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(Cl)c(I)cc2P)ccc2nonc12 |
| InChI | InChI=1S/C12H7ClIN4O3P/c13-5-3-9(10(22)4-6(5)14)15-8-2-1-7-11(17-21-16-7)12(8)18(19)20/h1-4,15H,22H2 |
| InChIKey | XHBLFFQUBZQPNV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|