C13H7F3N4O2S — CID 2821576
4-nitro-N-[3-(trifluoromethyl)phenyl]-2,1,3-benzothiadiazol-5-amine (PubChem CID 2821576) has the molecular formula C13H7F3N4O2S and a molecular weight of 340.29 g/mol. Its IUPAC name is 4-nitro-N-[3-(trifluoromethyl)phenyl]-2,1,3-benzothiadiazol-5-amine.
| Compound Name | 4-nitro-N-[3-(trifluoromethyl)phenyl]-2,1,3-benzothiadiazol-5-amine |
|---|---|
| PubChem CID | 2821576 |
| Molecular Formula | C13H7F3N4O2S |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-nitro-N-[3-(trifluoromethyl)phenyl]-2,1,3-benzothiadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ccc2nsnc12 |
| InChI | InChI=1S/C13H7F3N4O2S/c14-13(15,16)7-2-1-3-8(6-7)17-10-5-4-9-11(19-23-18-9)12(10)20(21)22/h1-6,17H |
| InChIKey | CPJZXIVRWUWBPS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|