C17H12F3N3O2 — CID 67339476
6-methyl-5-nitro-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine (PubChem CID 67339476) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 6-methyl-5-nitro-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine.
| Compound Name | 6-methyl-5-nitro-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 67339476 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-methyl-5-nitro-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine |
| SMILES | Cc1ccc2c(Nc3cccc(C(F)(F)F)c3)nccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12F3N3O2/c1-10-5-6-14-13(15(10)23(24)25)7-8-21-16(14)22-12-4-2-3-11(9-12)17(18,19)20/h2-9H,1H3,(H,21,22) |
| InChIKey | CHHQHNAHWRATJS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|