C16H9F4N3O2 — CID 163272242
6-methyl-5-nitro-N-(2,3,5,6-tetrafluorophenyl)isoquinolin-1-amine (PubChem CID 163272242) has the molecular formula C16H9F4N3O2 and a molecular weight of 351.26 g/mol. Its IUPAC name is 6-methyl-5-nitro-N-(2,3,5,6-tetrafluorophenyl)isoquinolin-1-amine.
| Compound Name | 6-methyl-5-nitro-N-(2,3,5,6-tetrafluorophenyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 163272242 |
| Molecular Formula | C16H9F4N3O2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 6-methyl-5-nitro-N-(2,3,5,6-tetrafluorophenyl)isoquinolin-1-amine |
| SMILES | Cc1ccc2c(Nc3c(F)c(F)cc(F)c3F)nccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9F4N3O2/c1-7-2-3-9-8(15(7)23(24)25)4-5-21-16(9)22-14-12(19)10(17)6-11(18)13(14)20/h2-6H,1H3,(H,21,22) |
| InChIKey | JRZRHBFDYCVKKK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|