C11H6F4N4O2 — CID 107647104
3-nitro-2-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,6-diamine (PubChem CID 107647104) has the molecular formula C11H6F4N4O2 and a molecular weight of 302.19 g/mol. Its IUPAC name is 3-nitro-2-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,6-diamine.
| Compound Name | 3-nitro-2-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 107647104 |
| Molecular Formula | C11H6F4N4O2 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-nitro-2-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,6-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])c(Nc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C11H6F4N4O2/c12-4-3-5(13)9(15)10(8(4)14)18-11-6(19(20)21)1-2-7(16)17-11/h1-3H,(H3,16,17,18) |
| InChIKey | ZEFIBSFZILFMSI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|